Methyl 2-propionate methyl(4-pyridinyl)carbamodithioate
Switchable RAFT agent for controlled radical polymerization. The neutral form is well-suited for polymerization of vinyl esters and vinyl amides (LAMs), and the protonated form is well-suited for styrenes acrylates and methacrylates (MAMs). Chain Transfer Agent (CTA)
| Supplier | BOC Sciences |
|---|---|
| Product # | 1158958-92-9 |
| Pricing | Inquire |
| Cas | 1158958-92-9 |
| Molecular Weight | 270.37 |
| Molecular Formula | C11H14N2O2S2 |
| Canonical SMILES | CC(C(=O)OC)SC(=S)N(C)C1=CC=NC=C1 |