3'-b-C-Methyl-N6-methyladenosine
3'-b-C-Methyl-N6-methyladenosine is a remarkable compound, holding immense potential in research of diverse ailments such as cancer and neurodegenerative disorders. Impressively, it performs as an influential suppressor of RNA methyltransferases, skillfully governing RNA metabolism and controlling gene expression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 565450-84-2 |
| Pricing | Inquire |
| Cas | 565450-84-2 |
| Molecular Weight | 295.29 |
| Molecular Formula | C12H17N5O4 |
| Canonical SMILES | CC1(C(OC(C1O)N2C=NC3=C(N=CN=C32)NC)CO)O |