8-Amino-Inosine
8-Amino-Inosine is a derivative of Inosine, a nucleoside that is found in tRNAs and is essential for the proper translation of genetic code in a wobble base pair. Inosine is also known to exert neuroprotective properties and has been used to treat stroke patients to restore neural function. 8-Amino-Inosine have been studied as a potential chemotherapeutic agent for the treatment of leukemia function by the cytodestruction of the neoplastic cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 13389-16-7 |
| Pricing | Inquire |
| Cas | 13389-16-7 |
| Molecular Weight | 283.24 |
| Molecular Formula | C10H13N5O5 |
| Canonical SMILES | C1=NC2=C(C(=O)N1)N=C(N2C3C(C(C(O3)CO)O)O)N |