2-Nicotinamide-2,3,5-tri-O-acetyl-b-D-riboside bromide
2-Nicotinamide-2,3,5-tri-O-acetyl-b-D-riboside bromide, a highly intriguing and multifaceted biomedicine, unveils its remarkable therapeutic prowess in combating an array of afflictions. Serving as an invaluable forerunner to nicotinamide adenine dinucleotide (NAD+), a quintessential coenzyme orchestrating cellular energy metabolism, this exceptional compound exhibits vast potential in lending respite to maladies encompassing cancer, neurodegenerative disorders, and metabolic aberrations. Gifting unparalleled regulation of cellular processes and DNA reparation, its impact on the intricate machinery of life is undoubtedly profound.
| Supplier | BOC Sciences |
|---|---|
| Product # | 78687-38-4 |
| Pricing | Inquire |
| Cas | 78687-38-4 |
| Molecular Weight | 461.26 |
| Molecular Formula | C17H21BrN2O8 |
| Canonical SMILES | CC1=C(N=CC=C1)C(=O)N.CC(=O)OCC1C(C(C(O1)(O)Br)OC(=O)C)OC(=O)C |