SOS1-IN-5
SOS1-IN-5 is a pyrimidobicyclic derivative and a potent inhibitor of SOS1. SOS1-IN-5 blocks the activation of KRAS by interfering with RAS-SOS1 interaction, and achieves the purpose of broad-spectrum inhibition of KRAS activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2716956-47-5 |
| Pricing | Inquire |
| Cas | 2716956-47-5 |
| Molecular Weight | 536.54 |
| Molecular Formula | C26H31F3N4O5 |
| Canonical SMILES | CC1=NC2=CC3=C(C=C2C(=N1)NC(C)C4=CC(=CC(=C4)N)C(F)(F)F)OCCOCCOCCOCCO3 |