2-Nicotinamide-b-D-riboside sulfate
2-Nicotinamide-b-D-riboside sulfate, a supplement compound extensively applied in the biomedicine sector, is commonly used for treating age-related illnesses like Alzheimer's, Parkinson's, and cardiovascular diseases. What makes it noteworthy is its ability to enhance mitochondrial function alongside an increase in energy metabolism, thereby promoting better health and a longer lifespan.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1713228-05-7 |
| Pricing | Inquire |
| Cas | 1713228-05-7 |
| Molecular Weight | 606.60 |
| Molecular Formula | C22H30N4O14S |
| Canonical SMILES | C1=CC(=C[N+](=C1)C2C(C(C(O2)CO)O)O)C(=O)N.C1=CC(=C[N+](=C1)C2C(C(C(O2)CO)O)O)C(=O)N.[O-]S(=O)(=O)[O-] |