7-(Cyano)-7-deazaguanosine
7-(Cyano)-7-deazaguanosine, a remarkable biomedicine of immense potential, has emerged as a therapeutic breakthrough in the battle against a myriad of diseases. This extraordinary compound showcases an array of antiviral and antitumor properties, positioning it as an excellent candidate for precise, targeted interventions in specific cancers and viral afflictions. Its distinctive mechanism involves perturbing crucial cellular processes, effectively impeding viral replication and restraining malignant proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 57128-90-2 |
| Pricing | Inquire |
| Cas | 57128-90-2 |
| Molecular Weight | 276.25 |
| Molecular Formula | C12H12N4O4 |
| Canonical SMILES | C1=C2C(=CN(C2=NC=N1)C3C(C(C(O3)CO)O)O)C#N |