(2S,3R,4S,5R)-2-(6-Amino-2-chloro-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol
(2S,3R,4S,5R)-2-(6-Amino-2-chloro-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol - a nucleoside analogue antiviral drug renowned for its ability to effectively combat diverse viral infections, including the insidious HIV and hepatitis C. Through its mechanism of action, which involves suppressing viral genetic material replication, it halts rampant viral multiplication and spreading in the body, thus safeguarding it from further damage. Its potency and efficacy have made it a valuable asset in the therapeutic intervention of various viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2015222-35-0 |
| Pricing | Inquire |
| Cas | 2015222-35-0 |
| Molecular Weight | 301.69 |
| Molecular Formula | C10H12ClN5O4 |
| Canonical SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)O)Cl)N |