D-Glucuronic acid,sodium salt
Chiral D-Glucuronic acid is the most basic building block of hyaluronic acid and chondroitin sulfate and precursor of Vitamin C, the chief detoxifying agent in both plants and animals. Humectant in skin care products.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14984-34-0 |
| Pricing | Inquire |
| Cas | 14984-34-0 |
| Molecular Weight | 216.12 |
| Molecular Formula | C6H9NaO7 |
| Canonical SMILES | C(=O)C(C(C(C(C(=O)[O-])O)O)O)O.[Na+] |