17:1 Lyso PS sodium salt
17:1 Lyso PS sodium salt, a compound widely utilized in the biomedical field, plays a crucial role in the exploration of phosphatidylserine's implications in disease pathogenesis and pharmacological responses. Its application spans across investigations into neurodegenerative maladies and oncological therapy optimizations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1246298-15-6 |
| Pricing | Inquire |
| Cas | 1246298-15-6 |
| Molecular Weight | 531.55 |
| Molecular Formula | C23H43NNaO9P |
| Canonical SMILES | CCCCCCC=CCCCCCCCCC(=O)OCC(COP(=O)([O-])OCC(C(=O)[O-])[NH3+])O.[Na+] |