2-Acetamido-2,4-dideoxy-4-fluoro-D-galactopyranose
2-Acetamido-2,4-dideoxy-4-fluoro-D-galactopyranose is a valuable compound widely used in the biomedical industry. This compound exhibits potential therapeutic effects in treating various diseases, especially those caused by pathogenic bacteria. Additionally, it serves as a crucial precursor in the synthesis of drugs targeting antibiotic-resistant strains.
| Supplier | BOC Sciences |
|---|---|
| Product # | 129728-92-3 |
| Pricing | Inquire |
| Cas | 129728-92-3 |
| Molecular Weight | 223.20 |
| Molecular Formula | C8H14FNO5 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1O)CO)F)O |