N-[2-(4-oxo-4H-3,1-benzoxazin-2-yl)phenyl]-2-naphthalenesulfonamide
N-[2-(4-oxo-4H-3,1-benzoxazin-2-yl)phenyl]-2-naphthalenesulfonamide, a profound small molecule inhibitor designed to target Cancerous Enzyme Carbonic Anhydrase IX (CAIX). This molecule is capable of exhibiting its potential therapeutic efficacy against various malignancies in numerous body sites including Breast, Prostate, and Kidney. This inhibitor is highly recommended due to its ability to repress the CAIX activity, a pivotal catalyst responsible for tumor inception, advancement, and invasion, rendering it a glimmer of hope as a Cancer treatment.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-013690 |
| Pricing | Inquire |
| Cas | 10128-55-9 |
| Molecular Weight | 428.46 |
| Molecular Formula | C24H16N2O4S |
| Canonical SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)NC3=CC=CC=C3C4=NC5=CC=CC=C5C(=O)O4 |