2-Bromo-4'-(trifluoromethoxy)acetophenone
2-Bromo-4'-(trifluoromethoxy)acetophenone (CAS# 103962-10-3) is an intermediate used to prepare aminothiazoles as therapeutic leads for prion diseases. It is also used in the synthesis of pyrrolidino-tetrahydroisoquinolines as potent dual H3 antagonist and serotonin transporter inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 103962-10-3 |
| Pricing | Inquire |
| Cas | 103962-10-3 |
| Molecular Weight | 283.04 |
| Molecular Formula | C9H6BrF3O2 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)CBr)OC(F)(F)F |