(Ala1)-PAR-4 (1-6) (mouse)
(Ala1)-PAR-4 (1-6) (mouse) is a peptide used in compound to study the role of PAR-4 (Prostate Apoptosis Response 4) in mice. It is specifically designed to mimic the first six amino acids of mouse PAR-4 and is utilized to investigate its function and potential therapeutic targets in diseases such as cancer and apoptosis-related disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015243 |
| Pricing | Inquire |
| Cas | 380900-00-5 |
| Molecular Weight | 681.78 |
| Molecular Formula | C34H47N7O8 |
| Canonical SMILES | CC(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N2CCCC2C(=O)NCC(=O)NC(CCCCN)C(=O)NC(CC3=CC=CC=C3)C(=O)O)N |