N-Boc-trans-4-fluoro-L-proline methyl ester
N-Boc-trans-4-fluoro-L-proline methyl ester, a critical entity pervasively employed in the pharmaceutical sector, emerges as a fundamental constituent facilitating synthesis across diverse compounds. Its pivotal role extends to the realm of drug development for targeted disease intervention, exemplifying its versatility and significance in medicinal advancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 203866-18-6 |
| Pricing | Inquire |
| Cas | 203866-18-6 |
| Molecular Weight | 247.26 |
| Molecular Formula | C11H18FNO4 |
| Canonical SMILES | CC(C)(C)OC(=O)N1CC(CC1C(=O)OC)F |