Ezetimibe Fluoro Isomer
A stereoisomer of Ezetimibe. Ezetimibe inhibits intestinal cholesterol absorption by preventing cholesterol uptake by the Niemann-Pick C1-like 1 (NPC1L9) protein, a cholesterol transporter located in the apical membrane of enterocytes.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0026-471388 |
| Pricing | Inquire |
| Cas | 1798008-25-9 |
| Molecular Weight | 409.44 |
| Molecular Formula | C24H21F2NO3 |
| Canonical SMILES | C1=CC=C(C(=C1)C(CCC2C(N(C2=O)C3=CC=C(C=C3)F)C4=CC=C(C=C4)O)O)F |