7-Deaza-2'-deoxyinosine
7-Deaza-2'-deoxyinosine is a nucleoside analog commonly used as an antiviral agent against viral infections such as hepatitis B and C. It works by inhibiting viral DNA polymerase and blocking viral replication. Additionally, it has shown potential in the treatment of cancer as a DNA synthesis inhibitor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 97224-58-3 |
| Pricing | Inquire |
| Cas | 97224-58-3 |
| Molecular Weight | 251.24 |
| Molecular Formula | C11H13N3O4 |
| Canonical SMILES | C1C(C(OC1N2C=CC3=C2N=CNC3=O)CO)O |