2'-O-tert-Butyldimethylsilyl-O4-(4-chlorophenyl)-5'-O-DMT-uridine 3'-CE-phosphoramidite
2'-O-tert-Butyldimethylsilyl-O4-(4-chlorophenyl)-5'-O-DMT-uridine 3'-CE-phosphoramidite is a compound used in the biomedical industry for the research and development of oligonucleotides. It is utilized in the development of nucleic acid-based drugs and diagnostic tools for the reserch of various diseases, including genetic disorders and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 220382-28-5 |
| Pricing | Inquire |
| Cas | 220382-28-5 |
| Molecular Weight | 971.60 |
| Molecular Formula | C51H64CIN4O9PS |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=CC(=NC2=O)OC3=CC=C(C=C3)Cl)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |