Colistin B
It is produced by the strain of Bacillus polymyxa var. colistinus and Bac. colistinum Koyama 70-B. It has good anti-gram-negative bacterial activity, but has poor effect on Pseudomonas aeruginosa and Proteus aeruginosa. Colistin B is used as an antibiotic in the treatment of infectious diseases resulting from multi-drug resistant (MDR) gram-negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01038 |
| Pricing | Inquire |
| Cas | 7239-48-7 |
| Molecular Weight | 1155.43 |
| Molecular Formula | C52H98N16O13 |
| Canonical SMILES | CC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CC(C)C)CC(C)C)CCN)CCN)C(C)O |