(βR)-2-Chloro-β-hydroxy-β-methyl-4-nitro-1H-imidazole-1-propanol 1-Methanesulfonate
(βR)-2-Chloro-β-hydroxy-β-methyl-4-nitro-1H-imidazole-1-propanol 1-Methanesulfonate is an intermediate in the synthesis of Delamanid (D230660), a novel anti-tuberculosis medication that inhibits mycolic acid synthesis and shows potent in-vitro and in-vivo activity against drug-resistant strains of Mycobacterium tuberculosis.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB062344 |
| Pricing | Inquire |
| Cas | 681490-92-6 |
| Molecular Weight | 313.72 |
| Molecular Formula | C8H12ClN3O6S |
| Canonical SMILES | CC(CN1C=C(N=C1Cl)[N+](=O)[O-])(COS(=O)(=O)C)O |