5-Aza-N6-benzoyl-5'-O-DMT-2'-deoxycytidine 3'-CE phosphoramidite
5-Aza-N6-benzoyl-5'-O-DMT-2'-deoxycytidine 3'-CE phosphoramidite, a bio-molecular tool, facilitates the integration of 5-aza-2'-deoxycytidine into oligonucleotides. This inhibits DNA methyltransferase and affords therapeutic benefits such as anti-cancer activity. The phosphoramidite reagent is a research asset that enables differential and accurate DNA sequence modification for targeted epigenetic investigation. It thus contributes to newer approaches in therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 929904-98-3 |
| Pricing | Inquire |
| Cas | 929904-98-3 |
| Molecular Weight | 864.92 |
| Molecular Formula | C46H53N6O9P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC(=NC5=O)NC(=O)COC6=CC=CC=C6 |