Phenochalasin B
It is produced by the strain of Phomopsis sp. FT-0211. Phenochalasin A (less than 20 μmol/L) can reduce the number and size of lipid droplets in macrophages without showing any cytotoxicity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02390 |
| Pricing | Inquire |
| Cas | 207679-46-7 |
| Molecular Weight | 525.59 |
| Molecular Formula | C29H35NO8 |
| Canonical SMILES | CC1CC=CC2C3C(O3)(C(C4C2(C(=O)NC4CC5=CC=C(C=C5)OC)OC(=O)OC=CC(C1=O)(C)O)C)C |