Glucagon Receptor Antagonist Inactive Control
Glucagon receptor antagonist inactive control is an analog of glucagon receptor antagonist I. It doesn't have effect on glucagon-induced glycogenolysis in primary human hepatocytes when used at concentrations of 10 or 30 µM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 362482-00-6 |
| Pricing | Inquire |
| Cas | 362482-00-6 |
| Molecular Weight | 431.4 |
| Molecular Formula | C21H23BrN2OS |
| Canonical SMILES | CCC(C)(C)C1CCC2=C(C1)SC(=C2C#N)NC(=O)C3=CC=C(C=C3)Br |