5'-O-DMT-2'-O-methyl-5-methyluridine
5'-O-DMT-2'-O-methyl-5-methyluridine is a modified nucleoside molecule that contains a 5'-O-dimethoxytrityl (DMT) group on the 5' carbon, a 2'-O-methyl group on the 2' carbon, and a methyl group on the 5th carbon of the uracil base. This modification is commonly used in nucleic acid synthesis and research to protect and manipulate nucleosides for various applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 153631-19-7 |
| Pricing | Inquire |
| Cas | 153631-19-7 |
| Molecular Weight | 574.62 |
| Molecular Formula | C32H34N2O8 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O)OC |