18:1 PE-N-18:1 Ammonium salt
18:1 PE-N-18:1 Ammonium salt is used as a lipid molecule to study cell membrane structure and function, as well as for drug delivery applications targeting specific diseases such as cancer and diabetes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2315262-06-5 |
| Pricing | Inquire |
| Cas | 2315262-06-5 |
| Molecular Weight | 1025.51 |
| Molecular Formula | C59H113N2O9P |
| Canonical SMILES | [NH4+].CCCCCCCC/C=C\CCCCCCCC(=O)NCCOP([O-])(=O)OC[C@@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC |