Methyl 8-Desacetyl-8-carboxy Daunorubicin
Methyl 8-Desacetyl-8-carboxy Daunorubicin is an impurity of Daunorubicin, which is an anthracycline antibiotic used in the treatment of acute myeloid and lymphocytic leukemia, with adverse reactions such as cardiotoxicity and bone marrow suppression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68833-10-3 |
| Pricing | Inquire |
| Cas | 68833-10-3 |
| Molecular Weight | 543.52 |
| Molecular Formula | C27H29NO11 |
| Canonical SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)OC)O)N)O |