Folic Acid-[d4]
Folic Acid-[d4] is the labelled analogue of Folic acid. Folic acid is a vitamin needed to synthesize DNA, conduct DNA repair and methylate DNA, and it also acts as a cofactor in biological reactions involving folate.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-011872 |
| Pricing | Inquire |
| Cas | 171777-72-3 |
| Molecular Weight | 445.42 |
| Molecular Formula | C19H15D4N7O6 |
| Canonical SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |