Aflatoxin G1
It is produced by the strain of Aspergillus flavus, Asp. parasiticus. The compound of aflatoxin has the activity of anti-gram-positive bacteria, inhibits cell mitosis, has the effect of liver necrosis and carcinogenesis, and is a mycotoxin which contaminates food.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1165-39-5 |
| Pricing | Inquire |
| Cas | 1165-39-5 |
| Molecular Weight | 328.27 |
| Molecular Formula | C17H12O7 |
| Canonical SMILES | COC1=C2C3=C(C(=O)OCC3)C(=O)OC2=C4C5C=COC5OC4=C1 |