2-Chloro-3-deazaadenosine
2-chloro-3-Deazaadenosine is a stable analog of adenosine that acts as an agonist for adenosine receptors (Ki = 0.3, 0.08, 25.5, and 1.9 μM for A1, A2A, A2B, and A3 receptors, respectively). It can block neurotransmitter release by activating A1 receptors or inhibit neurotransmission by activating A2A receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40656-71-1 |
| Pricing | Inquire |
| Cas | 40656-71-1 |
| Molecular Weight | 300.7 |
| Molecular Formula | C11H13ClN4O4 |
| Canonical SMILES | C1=C2C(=C(N=C1Cl)N)N=CN2C3C(C(C(O3)CO)O)O |