Omeprazole S-Isomer
Omeprazole S-Isomer is an impurity of Omeprazole. Omeprazole is a proton pump inhibitor used in the treatment of dyspepsia. It binds to the proton pump hydrogen-potassium adenosine triphosphatase (H+/K+ ATPase) and inhibits its activity and the parietal cell secretion of H+ ions into the gastric lumen.
| Supplier | BOC Sciences |
|---|---|
| Product # | 119141-88-7 |
| Pricing | Inquire |
| Cas | 119141-88-7 |
| Molecular Weight | 345.42 |
| Molecular Formula | C17H19N3O3S |
| Canonical SMILES | CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC |