NH2-PEG4-Lys(t-Boc)-NH-m-PEG24
NH2-PEG4-Lys(t-Boc)-NH-m-PEG24 is a PEG linker containing a terminal primary amine and a t-Boc protected lysine. The primary amine can react with carboxylic acids, activated NHS esters and other carbonyl groups. The t-Boc protecting group can the removed under acidic conditions. The hydrophilic PEG chains increase the water solubility of a compound in aqueous enviornments. Longer PEG chains have improved solubility relative to shorter PEG chains. Please contact us for GMP-grade inquiries.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-4711 |
| Pricing | Inquire |
| Molecular Weight | 1563.9 |
| Molecular Formula | C71H142N4O32 |
| Canonical SMILES | CC(C)(C)OC(=O)NCCCCC(C(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC)NC(=O)CCOCCOCCOCCOCCN |