5'-O-(t-Butyldimethylsilyl)thymidine
5'-O-(t-Butyldimethylsilyl)thymidine is a modified form of thymidine used in the biomedical industry. It is commonly employed in the synthesis of nucleic acid analogs and oligonucleotides for research purposes. Its t-butyldimethylsilyl group protects the thymidine molecule during the chemical reactions. It finding application in drug discovery, especially for developing antiviral and anticancer drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40733-28-6 |
| Pricing | Inquire |
| Cas | 40733-28-6 |
| Molecular Weight | 356.49 |
| Molecular Formula | C16H28N2O5Si |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO[Si](C)(C)C(C)(C)C)O |