Warfarin Potassium
Warfarin Potassium, an anticoagulant medication utilized in the treatment and prevention of blood clots, is frequently prescribed for various medical conditions, including deep vein thrombosis, pulmonary embolism, and atrial fibrillation. Its mechanism of action involves the inhibition of clotting factors in the bloodstream, thereby mitigating the likelihood of clot development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2610-86-8 |
| Pricing | Inquire |
| Cas | 2610-86-8 |
| Molecular Weight | 346.42 |
| Molecular Formula | C19H15KO4 |
| Canonical SMILES | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)[O-].[K+] |