Fludarabine Phosphate Impurity F
Fludarabine Phosphate Impurity F is a byproduct found in the manufacturing process of the chemotherapy drug Fludarabine Phosphate, which is used to treat B-cell chronic lymphocytic leukemia and lymphoma. Its exact role in the biomedical industry is not well understood and further research is needed.
| Supplier | BOC Sciences |
|---|---|
| Product # | 159002-28-5 |
| Pricing | Inquire |
| Cas | 159002-28-5 |
| Molecular Weight | 391.28 |
| Molecular Formula | C12H18N5O8P |
| Canonical SMILES | CCOC1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O)N |