PseudoUridine 5'-monophosphate
A metabolic process has been acknowledged for pseudoUridine, and it involves the pseudoUridine phosphorylation to generate pseudoUridine 5ʹ-monophosphate (ΨMP) catalyzed by the enzyme pseudoUridine kinase and thereafter the C-C glycosidic bond cleavage to give uracil and ribose 5-phosphate which mediated by the pseudoUridine 5ʹ-monophosphate glycosidase.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1157-60-4 |
| Pricing | Inquire |
| Cas | 1157-60-4 |
| Molecular Weight | 324.18 |
| Molecular Formula | C9H13N2O9P |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1)C2C(C(C(O2)COP(=O)(O)O)O)O |