3-Fluorobenzylzinc chloride solution
3-Fluorobenzylzinc chloride solution is an organometallic compound containing zinc atoms bonded to 3-fluorobenzyl groups and chloride ions. It is commonly used as a reagent in organic synthesis, especially in cross-coupling reactions such as the Suzuki-Miyaura reaction. This solution is typically prepared by reacting 3-fluorobenzyl chloride with zinc metal in the presence of a chloride source such as zinc chloride or hydrochloric acid.
| Supplier | BOC Sciences |
|---|---|
| Product # | 312693-06-4 |
| Pricing | Inquire |
| Cas | 312693-06-4 |
| Molecular Weight | 209.96 |
| Molecular Formula | FC6H4CH2ZnCl |
| Canonical SMILES | [CH2-]C1=CC(=CC=C1)F.Cl[Zn+] |