beta-Gal-Et-N3
beta-Gal-Et-N3 is an indispensable compound, finding multifarious applications steming from its remarkable utility in exploring the intricate world of glycosylation and galactosyltransferase activity. Possessing an unparalleled chemical architecture, this remarkable compound facilitates the exclusive marking and observation of beta-galactosidase enzymes, thereby significantly contributing to the identification and research of afflictions like cancer and lysosomal storage disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 151651-54-6 |
| Pricing | Inquire |
| Cas | 151651-54-6 |
| Molecular Weight | 249.22 |
| Molecular Formula | C8H15N3O6 |
| Canonical SMILES | C(COC1C(C(C(C(O1)CO)O)O)O)N=[N+]=[N-] |