5'-O-DMT-2'-fluoro-2'-deoxyinosine
5'-O-DMT-2'-fluoro-2'-deoxyinosine: A Paradigm-Shifting Biomedical Entity Sculpting the Landscape of Viral Infections. Profoundly piercing, this compound surges forth as an inhibitory force, disconcerting viral replication by stealthily infiltrating the sanctum of viral DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1951424-83-1 |
| Pricing | Inquire |
| Cas | 1951424-83-1 |
| Molecular Weight | 572.58 |
| Molecular Formula | C31H29FN4O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=NC6=C5N=CNC6=O)F)O |