2-Amino-N6,N6-dimethyl-2'-deoxy-2'-fluoro-beta-D-arabinoadenosine
2-Amino-N6,N6-dimethyl-2'-deoxy-2'-fluoro-beta-D-arabinoadenosine, a powerful antiviral drug, has proven effective in controlling hepatitis C viral infections. Its potent mechanism of action involves binding to and inhibiting the viral RNA polymerase, thereby reducing viral replication, viral load and disease progression. Not content with tackling hepatitis C alone, this remarkable compound has also been investigated for its potential use against HIV, influenza and even select cancers like chronic lymphocytic leukemia. Its versatility and unique mechanism of action make 2-Amino-N6,N6-dimethyl-2'-deoxy-2'-fluoro-beta-D-arabinoadenosine a valuable addition to any clinician's armamentarium in the battle against viral infections and other diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2171103-80-1 |
| Pricing | Inquire |
| Cas | 2171103-80-1 |
| Molecular Weight | 312.30 |
| Molecular Formula | C12H17FN6O3 |
| Canonical SMILES | CN(C)C1=NC(=NC2=C1N=CN2C3C(C(C(O3)CO)O)F)N |