Kanamycin A sulfate
Kanamycin, an aminoglycoside antibiotic first isolated from the bacterium Streptomyces kanamyceticus, has inhibitory effect on gram-positive and negative bacteria and mycoplasma. It can be used for the prevention and treatment of chicken pullorum, colibacillosis, enteritis and other diseases, and has a significant effect on systemic sepsis, respiratory tract infection, peritonitis caused by drug-resistant bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 25389-94-0 |
| Pricing | Inquire |
| Cas | 25389-94-0 |
| Molecular Weight | 582.58 |
| Molecular Formula | C18H38N4O15S |
| Canonical SMILES | C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O |