1-(Acetyloxy)-1-methylethyl 4-nitrophenyl Ester Carbonic Acid
1-(Acetyloxy)-1-methylethyl 4-nitrophenyl ester Carbonic Acid is a synergistic antihypertensive compound. Used in the synthesis of N-(azacycloalkyl)-fused benzamide derivatives which are used as renin inhibitors for treating diseases such as hypertension
Supplier | BOC Sciences |
---|---|
Product # | BB075210 |
Pricing | Inquire |
Cas | 179419-27-3 |
Molecular Weight | 283.23 |
Molecular Formula | C12H13NO7 |
Canonical SMILES | CC(=O)OC(C)(C)OC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |