Guanylyl-3'-5'-cytidine ammonium salt
Guanylyl-3'-5'-cytidine ammonium salt is an indispensable compound with sector assuming a pivotal role in the research of multifarious afflictions such as neoplastic disorders and rampant viral invasions. By virtue of its indispensability, this invaluable compound serves as an indispensable implement for nucleotide synthesand RNA molecular construction.
| Supplier | BOC Sciences |
|---|---|
| Product # | 98046-67-4 |
| Pricing | Inquire |
| Cas | 98046-67-4 |
| Molecular Weight | 605.46 |
| Molecular Formula | C19H25N8O12P·NH3 |
| Canonical SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)COP(=O)(O)OC3C(OC(C3O)N4C=NC5=C4N=C(NC5=O)N)CO)O)O.N |