3-Chloro-4-methoxybenzeneboronic acid
Reactant for:• Iron-catalyzed oxidative coupling with benzene derivatives through homolytic aromatic substitution• Preparation of microtubule inhibitors as potential antitumors• Rhodium/chiral ligand-catalyzed arylation/Dieckmann-type annulation• Copper-catalyzed oxidative N-arylation• Suzuki and Stille palladium-catalyzed coupling• Boron-Heck arylation
| Supplier | BOC Sciences |
|---|---|
| Product # | 175883-60-0 |
| Pricing | Inquire |
| Cas | 175883-60-0 |
| Molecular Weight | 186.401 |
| Molecular Formula | ClC6H3(OCH3)B(OH)2 |
| Canonical SMILES | B(C1=CC(=C(C=C1)OC)Cl)(O)O |