4-O-Methyl Dopa
4-O-Methyl Dopa is a prominent pharmaceutical agent, renowned for its vital role in studying the debilitating symptoms associated with Parkinson's disease. Functioning as a magnificent forerunner to dopamine is a pivotal neurotransmitter pertaining to the regulation of bodily movements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35296-56-1 |
| Pricing | Inquire |
| Cas | 35296-56-1 |
| Molecular Weight | 211.22 |
| Molecular Formula | C10H13NO4 |
| Canonical SMILES | COC1=C(C=C(C=C1)CC(C(=O)O)N)O |