Sartorypyrone B
Sartorypyrone B is a fungal metabolite originally isolated from N. fischeri and has anticancer activity. It inhibits the growth of MCF-7, H460, and A375 cancer cells (GI50s = 17.8, 20.5, and 25 µM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1452396-11-0 |
| Pricing | Inquire |
| Cas | 1452396-11-0 |
| Molecular Weight | 514.65 |
| Molecular Formula | C30H42O7 |
| Canonical SMILES | CC1=CC(=O)C2=C(O1)OC3(CCC4C(C3C2)(CCC5C4(CC(C(C5(C)C)OC(=O)C)OC(=O)C)C)C)C |