(D-Galactopyranosyl)-b-D-thiogalactopyranoside
(D-Galactopyranosyl)-b-D-thiogalactopyranoside is a crucial compound widely used in the biomedical industry. It acts as a substrate analogue for enzymes involved in carbohydrate metabolism and is utilized in the study of glycoside hydrolases. It aids in the exploration of enzyme activity and glycosylation pathways, facilitating research on carbohydrate-related diseases and drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 51555-87-4 |
| Pricing | Inquire |
| Cas | 51555-87-4 |
| Molecular Weight | 358.36 |
| Molecular Formula | C12H22O10S |
| Canonical SMILES | C(C1C(C(C(C(O1)SC2C(C(C(C(O2)CO)O)O)O)O)O)O)O |