Urapidil-[d4] Hydrochloride
A labelled analog of Urapidil HCl. Urapidil HCl is a hydrochloride salt form of urapidil which is an α1-adrenoceptor antagonist and a 5-HT1A receptor agonist with pIC50 of 6.13 and 6.4 respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007556 |
| Pricing | Inquire |
| Cas | 1794979-63-7 |
| Molecular Weight | 427.96 |
| Molecular Formula | C20H26D4ClN5O3 |
| Canonical SMILES | CN1C(=CC(=O)N(C1=O)C)NCCCN2CCN(CC2)C3=CC=CC=C3OC.Cl |