R-Rivaroxaban
5-R-Rivaroxaban is the R-isomer of Rivaroxaban, which is a novel, oral, direct Factor Xa (FXa) inhibitor. It is useful for antithrombotic agent and is a promising drug for atrial fibrillation, venous thromboembolism or thromboembolic disorders in clinic.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2694-459985 |
| Pricing | Inquire |
| Cas | 865479-71-6 |
| Molecular Weight | 435.88 |
| Molecular Formula | C19H18ClN3O5S |
| Canonical SMILES | C1COCC(=O)N1C2=CC=C(C=C2)N3CC(OC3=O)CNC(=O)C4=CC=C(S4)Cl |