cGMP Dependent Kinase Inhibitor Peptide
| Supplier | Creative Peptides |
|---|---|
| Product # | R0846 |
| CAS # | 82801-73-8 |
| Pricing | Inquire |
| MolecularFormula | C38H74N18O10 |
| MolecularWeight | 943.12 |
| Sequence | Arg-Lys-Arg-Ala-Arg-Lys-Glu |
| Storage | -20°C |
| Application | Competitive inhibitor of cGMP-dependent protein kinase (PKG); analog of a substrate peptide corresponding to a phosphorylation site of histone H2B. Competes with synthetic substrates (Ki = 86 mM) but does not inhibit phosphorylation of intact histones by PKG. Inhibits phosphorylation of intact histones by PKA. |
| InChI | InChI=1S/C38H74N18O10/c1-21(29(59)52-26(13-8-20-50-38(46)47)33(63)54-24(11-3-5-17-40)34(64)56-27(35(65)66)14-15-28(57)58)51-31(61)25(12-7-19-49-37(44)45)55-32(62)23(10-2-4-16-39)53-30(60)22(41)9-6-18-48-36(42)43/h21-27H,2-20,39-41H2,1H3,(H,51,61)(H,52,59)(H,53,60)(H,54,63)(H,55,62)(H,56,64)(H,57,58)(H,65,66)(H4,42,43,48)(H4,44,45,49)(H4,46,47,50)/t21-,22-,23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | OUKSKNTVYYVIMZ-DUJSLOSMSA-N |
| IsomericSMILES | C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCN=C(N)N)N |
| Purity | >98 % |
| LongTermStorageConditions | -20 °C |