4-methoxy-5-(3-morpholinopropoxy)-2-nitrobenzamide
4-methoxy-5-(3-morpholinopropoxy)-2-nitrobenzamide is an impurity of Gefitinib. Gefitinib is an antineoplastic drug. Gefitinib effectively inhibits all tyrosine phosphorylation sites on EGFR in both the high and low EGFR-expressing cell lines including NR6, NR6M and NR6W cell lines. The phosphorylation sites Tyr1173 and Tyr992 are less sensitive requiring higher concentrations of Gefitinib for inhibition.
| Supplier | BOC Sciences |
|---|---|
| Product # | 861453-16-9 |
| Pricing | Inquire |
| Cas | 861453-16-9 |
| Molecular Weight | 339.34 |
| Molecular Formula | C15H21N3O6 |
| Canonical SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])C(=O)N)OCCCN2CCOCC2 |